C21H20N6O2S — CID 24888258
1-[5-[8-(4-morpholin-4-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl]ethanone (PubChem CID 24888258) has the molecular formula C21H20N6O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[5-[8-(4-morpholin-4-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[8-(4-morpholin-4-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 24888258 |
| Molecular Formula | C21H20N6O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[5-[8-(4-morpholin-4-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cnc(Nc3ccc(N4CCOCC4)cc3)c3ncnn23)s1 |
| InChI | InChI=1S/C21H20N6O2S/c1-14(28)18-6-7-19(30-18)17-12-22-20(21-23-13-24-27(17)21)25-15-2-4-16(5-3-15)26-8-10-29-11-9-26/h2-7,12-13H,8-11H2,1H3,(H,22,25) |
| InChIKey | QDKZNYZQKYAEMW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|