C26H27N8ORb — CID 143585611
5-[8-(4-piperazin-4-id-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one;prop-1-ene;rubidium(1+) (PubChem CID 143585611) has the molecular formula C26H27N8ORb and a molecular weight of 553.03 g/mol. Its IUPAC name is 5-[8-(4-piperazin-4-id-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one;prop-1-ene;rubidium(1+).
| Compound Name | 5-[8-(4-piperazin-4-id-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one;prop-1-ene;rubidium(1+) |
|---|---|
| PubChem CID | 143585611 |
| Molecular Formula | C26H27N8ORb |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 5-[8-(4-piperazin-4-id-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one;prop-1-ene;rubidium(1+) |
| SMILES | C=CC.O=C1NCc2cc(-c3cnc(Nc4ccc(N5CC[N-]CC5)cc4)c4ncnn34)ccc21.[Rb+] |
| InChI | InChI=1S/C23H21N8O.C3H6.Rb/c32-23-19-6-1-15(11-16(19)12-26-23)20-13-25-21(22-27-14-28-31(20)22)29-17-2-4-18(5-3-17)30-9-7-24-8-10-30;1-3-2;/h1-6,11,13-14H,7-10,12H2,(H,25,29)(H,26,32);3H,1H2,2H3;/q-1;;+1 |
| InChIKey | UNRZYIRAHJFHAV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|