C22H21N7O4 — CID 69494239
2-carbamoyl-5-[8-(4-piperazin-1-ylanilino)imidazo[1,2-a]pyrazin-5-yl]furan-3-carboxylic acid (PubChem CID 69494239) has the molecular formula C22H21N7O4 and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-carbamoyl-5-[8-(4-piperazin-1-ylanilino)imidazo[1,2-a]pyrazin-5-yl]furan-3-carboxylic acid.
| Compound Name | 2-carbamoyl-5-[8-(4-piperazin-1-ylanilino)imidazo[1,2-a]pyrazin-5-yl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 69494239 |
| Molecular Formula | C22H21N7O4 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-carbamoyl-5-[8-(4-piperazin-1-ylanilino)imidazo[1,2-a]pyrazin-5-yl]furan-3-carboxylic acid |
| SMILES | NC(=O)c1oc(-c2cnc(Nc3ccc(N4CCNCC4)cc3)c3nccn23)cc1C(=O)O |
| InChI | InChI=1S/C22H21N7O4/c23-19(30)18-15(22(31)32)11-17(33-18)16-12-26-20(21-25-7-10-29(16)21)27-13-1-3-14(4-2-13)28-8-5-24-6-9-28/h1-4,7,10-12,24H,5-6,8-9H2,(H2,23,30)(H,26,27)(H,31,32) |
| InChIKey | SLYGACUUNSVAOF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|