C24H24FN7O — CID 59023095
4-[8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]benzamide (PubChem CID 59023095) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]benzamide.
| Compound Name | 4-[8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]benzamide |
|---|---|
| PubChem CID | 59023095 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]benzamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4ccc(C(N)=O)cc4)n4ccnc34)cc2F)CC1 |
| InChI | InChI=1S/C24H24FN7O/c1-30-10-12-31(13-11-30)20-7-6-18(14-19(20)25)29-23-24-27-8-9-32(24)21(15-28-23)16-2-4-17(5-3-16)22(26)33/h2-9,14-15H,10-13H2,1H3,(H2,26,33)(H,28,29) |
| InChIKey | FMEGZOXBKCIRCI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|