C25H27N9O3 — CID 140706916
[6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl] N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate (PubChem CID 140706916) has the molecular formula C25H27N9O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is [6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl] N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate.
| Compound Name | [6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl] N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 140706916 |
| Molecular Formula | C25H27N9O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [6-(6-amino-5-methylpyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl] N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate |
| SMILES | Cc1ncc(-c2cn3ccnc3c(OC(=O)Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)nc1N |
| InChI | InChI=1S/C25H27N9O3/c1-16-22(26)30-20(12-28-16)21-13-34-7-6-27-23(34)24(31-21)37-25(35)29-17-2-4-18(5-3-17)32-8-10-33(11-9-32)19-14-36-15-19/h2-7,12-13,19H,8-11,14-15H2,1H3,(H2,26,30)(H,29,35) |
| InChIKey | YNUNNURAMYKZJJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|