C10H12ClN2NaOS — CID 155164258
sodium 3-chloro-2-(4-hydroxypiperidin-1-yl)pyridine-4-thiolate (PubChem CID 155164258) has the molecular formula C10H12ClN2NaOS and a molecular weight of 266.73 g/mol. Its IUPAC name is sodium 3-chloro-2-(4-hydroxypiperidin-1-yl)pyridine-4-thiolate.
| Compound Name | sodium 3-chloro-2-(4-hydroxypiperidin-1-yl)pyridine-4-thiolate |
|---|---|
| PubChem CID | 155164258 |
| Molecular Formula | C10H12ClN2NaOS |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | sodium 3-chloro-2-(4-hydroxypiperidin-1-yl)pyridine-4-thiolate |
| SMILES | OC1CCN(c2nccc([S-])c2Cl)CC1.[Na+] |
| InChI | InChI=1S/C10H13ClN2OS.Na/c11-9-8(15)1-4-12-10(9)13-5-2-7(14)3-6-13;/h1,4,7,14H,2-3,5-6H2,(H,12,15);/q;+1/p-1 |
| InChIKey | KSRKEYNNSKHXKY-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|