C22H23N3OS — CID 143516856
1-[2-[6-(4-ethylpiperidin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl]prop-2-en-1-one (PubChem CID 143516856) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-[2-[6-(4-ethylpiperidin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[6-(4-ethylpiperidin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143516856 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[2-[6-(4-ethylpiperidin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc2nc(-c3ccc(N4CCC(CC)CC4)nc3)sc2c1 |
| InChI | InChI=1S/C22H23N3OS/c1-3-15-9-11-25(12-10-15)21-8-6-17(14-23-21)22-24-18-7-5-16(19(26)4-2)13-20(18)27-22/h4-8,13-15H,2-3,9-12H2,1H3 |
| InChIKey | LURZCJSQHNRAIG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|