About [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate
[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate (PubChem CID 67276495) has the molecular formula C19H20N4O2S
and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate.
Molecular Properties
| Compound Name | [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate |
| PubChem CID | 67276495 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(-c3ccc(N4CCN(C)CC4)nc3)sc2c1 |
| InChI | InChI=1S/C19H20N4O2S/c1-13(24)25-15-4-5-16-17(11-15)26-19(21-16)14-3-6-18(20-12-14)23-9-7-22(2)8-10-23/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | GSUZCHGXCONFPD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate?
The IUPAC name of [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate (CID 67276495) is [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate.
What is the SMILES notation for [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate?
The canonical SMILES for [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate is CC(=O)Oc1ccc2nc(-c3ccc(N4CCN(C)CC4)nc3)sc2c1.
What is the InChIKey of [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate?
The InChIKey is GSUZCHGXCONFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2S/c1-13(24)25-15-4-5-16-17(11-15)26-19(21-16)14-3-6-18(20-12-14)23-9-7-22(2)8-10-23/h3-6,11-12H,7-10H2,1-2H3.
What are the key properties of [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate?
[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate has a molecular weight of 368.46 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate is sourced from PubChem (CID 67276495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).