C19H20N4O2S — CID 67276495
[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate (PubChem CID 67276495) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate.
| Compound Name | [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate |
|---|---|
| PubChem CID | 67276495 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1,3-benzothiazol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(-c3ccc(N4CCN(C)CC4)nc3)sc2c1 |
| InChI | InChI=1S/C19H20N4O2S/c1-13(24)25-15-4-5-16-17(11-15)26-19(21-16)14-3-6-18(20-12-14)23-9-7-22(2)8-10-23/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | GSUZCHGXCONFPD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|