C18H20N4O — CID 56896281
6-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 56896281) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 6-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 56896281 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cncc(COC2CCN(c3ccc4cc[nH]c4n3)CC2)c1 |
| InChI | InChI=1S/C18H20N4O/c1-2-14(12-19-8-1)13-23-16-6-10-22(11-7-16)17-4-3-15-5-9-20-18(15)21-17/h1-5,8-9,12,16H,6-7,10-11,13H2,(H,20,21) |
| InChIKey | DPBQGMJXWWZJIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |