C19H22F2N2O2 — CID 56886815
3-[[1-[[3-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]oxymethyl]pyridine (PubChem CID 56886815) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 3-[[1-[[3-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]oxymethyl]pyridine.
| Compound Name | 3-[[1-[[3-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 56886815 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-[[1-[[3-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]oxymethyl]pyridine |
| SMILES | FC(F)Oc1cccc(CN2CCC(OCc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c20-19(21)25-18-5-1-3-15(11-18)13-23-9-6-17(7-10-23)24-14-16-4-2-8-22-12-16/h1-5,8,11-12,17,19H,6-7,9-10,13-14H2 |
| InChIKey | JPBNFTVBDWYKMZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |