C17H26N2O3 — CID 171909488
3-[[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]oxymethyl]pyridine (PubChem CID 171909488) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]oxymethyl]pyridine.
| Compound Name | 3-[[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 171909488 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-[[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]oxymethyl]pyridine |
| SMILES | c1cncc(COC2CCN(CCC3OCCCO3)CC2)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-15(13-18-7-1)14-22-16-4-8-19(9-5-16)10-6-17-20-11-2-12-21-17/h1,3,7,13,16-17H,2,4-6,8-12,14H2 |
| InChIKey | PIKSGLGTKAEGFU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |