C21H29N3OS — CID 131932704
3-[[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]oxymethyl]pyridine (PubChem CID 131932704) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 3-[[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]oxymethyl]pyridine.
| Compound Name | 3-[[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 131932704 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-[[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]oxymethyl]pyridine |
| SMILES | c1cncc(COC2CCN(Cc3cc(CN4CCCC4)cs3)CC2)c1 |
| InChI | InChI=1S/C21H29N3OS/c1-2-9-23(8-1)14-19-12-21(26-17-19)15-24-10-5-20(6-11-24)25-16-18-4-3-7-22-13-18/h3-4,7,12-13,17,20H,1-2,5-6,8-11,14-16H2 |
| InChIKey | PVXNRXUYPYEQOV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |