C23H21NS — CID 155629099
6-(4-tert-butylphenyl)-2-phenylthieno[2,3-b]pyridine (PubChem CID 155629099) has the molecular formula C23H21NS and a molecular weight of 343.50 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-2-phenylthieno[2,3-b]pyridine.
| Compound Name | 6-(4-tert-butylphenyl)-2-phenylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 155629099 |
| Molecular Formula | C23H21NS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 6-(4-tert-butylphenyl)-2-phenylthieno[2,3-b]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2ccc3cc(-c4ccccc4)sc3n2)cc1 |
| InChI | InChI=1S/C23H21NS/c1-23(2,3)19-12-9-16(10-13-19)20-14-11-18-15-21(25-22(18)24-20)17-7-5-4-6-8-17/h4-15H,1-3H3 |
| InChIKey | ZDMFGUNHNPLKHY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |