C24H23NS — CID 155626337
6-(3-tert-butyl-5-methylphenyl)-2-phenylthieno[3,2-c]pyridine (PubChem CID 155626337) has the molecular formula C24H23NS and a molecular weight of 357.52 g/mol. Its IUPAC name is 6-(3-tert-butyl-5-methylphenyl)-2-phenylthieno[3,2-c]pyridine.
| Compound Name | 6-(3-tert-butyl-5-methylphenyl)-2-phenylthieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 155626337 |
| Molecular Formula | C24H23NS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-(3-tert-butyl-5-methylphenyl)-2-phenylthieno[3,2-c]pyridine |
| SMILES | Cc1cc(-c2cc3sc(-c4ccccc4)cc3cn2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H23NS/c1-16-10-18(12-20(11-16)24(2,3)4)21-14-23-19(15-25-21)13-22(26-23)17-8-6-5-7-9-17/h5-15H,1-4H3 |
| InChIKey | PILHEYCPONYNFP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |