C27H21NS — CID 155626807
2-(3,5-dimethylphenyl)-5-(3-phenylphenyl)thieno[2,3-c]pyridine (PubChem CID 155626807) has the molecular formula C27H21NS and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-5-(3-phenylphenyl)thieno[2,3-c]pyridine.
| Compound Name | 2-(3,5-dimethylphenyl)-5-(3-phenylphenyl)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 155626807 |
| Molecular Formula | C27H21NS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-5-(3-phenylphenyl)thieno[2,3-c]pyridine |
| SMILES | Cc1cc(C)cc(-c2cc3cc(-c4cccc(-c5ccccc5)c4)ncc3s2)c1 |
| InChI | InChI=1S/C27H21NS/c1-18-11-19(2)13-23(12-18)26-16-24-15-25(28-17-27(24)29-26)22-10-6-9-21(14-22)20-7-4-3-5-8-20/h3-17H,1-2H3 |
| InChIKey | LAEPIVIXFOIOSA-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |