C27H29NS — CID 155626837
2-(3,5-ditert-butylphenyl)-5-phenylthieno[2,3-c]pyridine (PubChem CID 155626837) has the molecular formula C27H29NS and a molecular weight of 399.60 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-5-phenylthieno[2,3-c]pyridine.
| Compound Name | 2-(3,5-ditert-butylphenyl)-5-phenylthieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 155626837 |
| Molecular Formula | C27H29NS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-5-phenylthieno[2,3-c]pyridine |
| SMILES | CC(C)(C)c1cc(-c2cc3cc(-c4ccccc4)ncc3s2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H29NS/c1-26(2,3)21-12-19(13-22(16-21)27(4,5)6)24-15-20-14-23(28-17-25(20)29-24)18-10-8-7-9-11-18/h7-17H,1-6H3 |
| InChIKey | QCEDZSDZZRAWEH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |