C19H19NS — CID 122594500
2-(3-tert-butylphenyl)-5-phenyl-1,3-thiazole (PubChem CID 122594500) has the molecular formula C19H19NS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-5-phenyl-1,3-thiazole.
| Compound Name | 2-(3-tert-butylphenyl)-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 122594500 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(3-tert-butylphenyl)-5-phenyl-1,3-thiazole |
| SMILES | CC(C)(C)c1cccc(-c2ncc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H19NS/c1-19(2,3)16-11-7-10-15(12-16)18-20-13-17(21-18)14-8-5-4-6-9-14/h4-13H,1-3H3 |
| InChIKey | QOWHNHHUUWEKOL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |