C23H19NS — CID 140714930
5-(2,6-dimethyl-4-phenylphenyl)-2-phenyl-1,3-thiazole (PubChem CID 140714930) has the molecular formula C23H19NS and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-(2,6-dimethyl-4-phenylphenyl)-2-phenyl-1,3-thiazole.
| Compound Name | 5-(2,6-dimethyl-4-phenylphenyl)-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 140714930 |
| Molecular Formula | C23H19NS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-(2,6-dimethyl-4-phenylphenyl)-2-phenyl-1,3-thiazole |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H19NS/c1-16-13-20(18-9-5-3-6-10-18)14-17(2)22(16)21-15-24-23(25-21)19-11-7-4-8-12-19/h3-15H,1-2H3 |
| InChIKey | NQVNBQUDDTXYES-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |