C12H8N2OS — CID 173298635
2-(2-phenyl-1,3-thiazol-5-yl)-1,3-oxazole (PubChem CID 173298635) has the molecular formula C12H8N2OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-thiazol-5-yl)-1,3-oxazole.
| Compound Name | 2-(2-phenyl-1,3-thiazol-5-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 173298635 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-(2-phenyl-1,3-thiazol-5-yl)-1,3-oxazole |
| SMILES | c1ccc(-c2ncc(-c3ncco3)s2)cc1 |
| InChI | InChI=1S/C12H8N2OS/c1-2-4-9(5-3-1)12-14-8-10(16-12)11-13-6-7-15-11/h1-8H |
| InChIKey | WQDFZTRKLGDXMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |