C9H7NO — CID 122401309
2-(2,6-dideuteriophenyl)-1,3-oxazole (PubChem CID 122401309) has the molecular formula C9H7NO and a molecular weight of 147.17 g/mol. Its IUPAC name is 2-(2,6-dideuteriophenyl)-1,3-oxazole.
| Compound Name | 2-(2,6-dideuteriophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 122401309 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-(2,6-dideuteriophenyl)-1,3-oxazole |
| SMILES | [2H]c1cccc([2H])c1-c1ncco1 |
| InChI | InChI=1S/C9H7NO/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-7H/i4D,5D |
| InChIKey | RQCBPOPQTLHDFC-KFRNQKGQSA-N |
| XLogP | 2.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |