C23H18N4S — CID 144501112
N-methylidene-N'-[2-methyl-4-(2-phenyl-1,3-thiazol-5-yl)phenyl]pyridine-3-carboximidamide (PubChem CID 144501112) has the molecular formula C23H18N4S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-methylidene-N'-[2-methyl-4-(2-phenyl-1,3-thiazol-5-yl)phenyl]pyridine-3-carboximidamide.
| Compound Name | N-methylidene-N'-[2-methyl-4-(2-phenyl-1,3-thiazol-5-yl)phenyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 144501112 |
| Molecular Formula | C23H18N4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-methylidene-N'-[2-methyl-4-(2-phenyl-1,3-thiazol-5-yl)phenyl]pyridine-3-carboximidamide |
| SMILES | C=N/C(=N\c1ccc(-c2cnc(-c3ccccc3)s2)cc1C)c1cccnc1 |
| InChI | InChI=1S/C23H18N4S/c1-16-13-18(21-15-26-23(28-21)17-7-4-3-5-8-17)10-11-20(16)27-22(24-2)19-9-6-12-25-14-19/h3-15H,2H2,1H3/b27-22- |
| InChIKey | AGITXKTVBWDRIB-QYQHSDTDSA-N |
| XLogP | 5.96 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|