C25H23F2N5OS — CID 144500802
N'-[2-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-ethoxyphenyl]-N-methylidenepyridine-3-carboximidamide;methanamine (PubChem CID 144500802) has the molecular formula C25H23F2N5OS and a molecular weight of 479.56 g/mol. Its IUPAC name is N'-[2-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-ethoxyphenyl]-N-methylidenepyridine-3-carboximidamide;methanamine.
| Compound Name | N'-[2-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-ethoxyphenyl]-N-methylidenepyridine-3-carboximidamide;methanamine |
|---|---|
| PubChem CID | 144500802 |
| Molecular Formula | C25H23F2N5OS |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N'-[2-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-ethoxyphenyl]-N-methylidenepyridine-3-carboximidamide;methanamine |
| SMILES | C=N/C(=N\c1ccc(OCC)cc1-c1nc(-c2cc(F)ccc2F)cs1)c1cccnc1.CN |
| InChI | InChI=1S/C24H18F2N4OS.CH5N/c1-3-31-17-7-9-21(29-23(27-2)15-5-4-10-28-13-15)19(12-17)24-30-22(14-32-24)18-11-16(25)6-8-20(18)26;1-2/h4-14H,2-3H2,1H3;2H2,1H3/b29-23-; |
| InChIKey | FPMRKJSMLORZOP-MBANDDHJSA-N |
| XLogP | 5.90 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|