C48H52 — CID 123394751
5-[3-[3,5-dimethyl-4-(3,4,5-trimethylphenyl)phenyl]-5-phenylphenyl]-1,3-dimethyl-2-(3,4,5-trimethylphenyl)benzene;ethane (PubChem CID 123394751) has the molecular formula C48H52 and a molecular weight of 628.94 g/mol. Its IUPAC name is 5-[3-[3,5-dimethyl-4-(3,4,5-trimethylphenyl)phenyl]-5-phenylphenyl]-1,3-dimethyl-2-(3,4,5-trimethylphenyl)benzene;ethane.
| Compound Name | 5-[3-[3,5-dimethyl-4-(3,4,5-trimethylphenyl)phenyl]-5-phenylphenyl]-1,3-dimethyl-2-(3,4,5-trimethylphenyl)benzene;ethane |
|---|---|
| PubChem CID | 123394751 |
| Molecular Formula | C48H52 |
| Molecular Weight | 628.94 g/mol |
| Exact Mass | 628.41 |
| IUPAC Name | 5-[3-[3,5-dimethyl-4-(3,4,5-trimethylphenyl)phenyl]-5-phenylphenyl]-1,3-dimethyl-2-(3,4,5-trimethylphenyl)benzene;ethane |
| SMILES | CC.Cc1cc(-c2c(C)cc(-c3cc(-c4ccccc4)cc(-c4cc(C)c(-c5cc(C)c(C)c(C)c5)c(C)c4)c3)cc2C)cc(C)c1C |
| InChI | InChI=1S/C46H46.C2H6/c1-27-16-43(17-28(2)35(27)9)45-31(5)20-38(21-32(45)6)41-24-40(37-14-12-11-13-15-37)25-42(26-41)39-22-33(7)46(34(8)23-39)44-18-29(3)36(10)30(4)19-44;1-2/h11-26H,1-10H3;1-2H3 |
| InChIKey | AHVOWNRGGOPPHB-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.94 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |