C80H84 — CID 123939497
ethane;1,2,3-trimethyl-5-[4-[3-phenyl-5-[3,4,5-tris(3,4,5-trimethylphenyl)phenyl]phenyl]-2,6-bis(3,4,5-trimethylphenyl)phenyl]benzene (PubChem CID 123939497) has the molecular formula C80H84 and a molecular weight of 1045.55 g/mol. Its IUPAC name is ethane;1,2,3-trimethyl-5-[4-[3-phenyl-5-[3,4,5-tris(3,4,5-trimethylphenyl)phenyl]phenyl]-2,6-bis(3,4,5-trimethylphenyl)phenyl]benzene.
| Compound Name | ethane;1,2,3-trimethyl-5-[4-[3-phenyl-5-[3,4,5-tris(3,4,5-trimethylphenyl)phenyl]phenyl]-2,6-bis(3,4,5-trimethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 123939497 |
| Molecular Formula | C80H84 |
| Molecular Weight | 1045.55 g/mol |
| Exact Mass | 1044.66 |
| IUPAC Name | ethane;1,2,3-trimethyl-5-[4-[3-phenyl-5-[3,4,5-tris(3,4,5-trimethylphenyl)phenyl]phenyl]-2,6-bis(3,4,5-trimethylphenyl)phenyl]benzene |
| SMILES | CC.Cc1cc(-c2cc(-c3cc(-c4ccccc4)cc(-c4cc(-c5cc(C)c(C)c(C)c5)c(-c5cc(C)c(C)c(C)c5)c(-c5cc(C)c(C)c(C)c5)c4)c3)cc(-c3cc(C)c(C)c(C)c3)c2-c2cc(C)c(C)c(C)c2)cc(C)c1C |
| InChI | InChI=1S/C78H78.C2H6/c1-43-24-67(25-44(2)55(43)13)73-39-65(40-74(68-26-45(3)56(14)46(4)27-68)77(73)71-32-51(9)59(17)52(10)33-71)63-36-62(61-22-20-19-21-23-61)37-64(38-63)66-41-75(69-28-47(5)57(15)48(6)29-69)78(72-34-53(11)60(18)54(12)35-72)76(42-66)70-30-49(7)58(16)50(8)31-70;1-2/h19-42H,1-18H3;1-2H3 |
| InChIKey | FZNMOTACCGUMJS-UHFFFAOYSA-N |
| XLogP | 23.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.55 |
| LogP ≤ 5 | 23.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |