C34H30S — CID 143197342
4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-dimethylphenyl]benzenethiol (PubChem CID 143197342) has the molecular formula C34H30S and a molecular weight of 470.68 g/mol. Its IUPAC name is 4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-dimethylphenyl]benzenethiol.
| Compound Name | 4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-dimethylphenyl]benzenethiol |
|---|---|
| PubChem CID | 143197342 |
| Molecular Formula | C34H30S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-dimethylphenyl]benzenethiol |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1ccc(-c2c(C)cc(-c3ccc(S)cc3)cc2C)cc1 |
| InChI | InChI=1S/C34H30S/c1-22-18-30(26-8-6-5-7-9-26)19-23(2)33(22)28-10-12-29(13-11-28)34-24(3)20-31(21-25(34)4)27-14-16-32(35)17-15-27/h5-21,35H,1-4H3 |
| InChIKey | KUEPOGZQMPUGCN-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|