C41H50O3Si3 — CID 59664304
[4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]-trimethoxysilane (PubChem CID 59664304) has the molecular formula C41H50O3Si3 and a molecular weight of 675.11 g/mol. Its IUPAC name is [4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]-trimethoxysilane.
| Compound Name | [4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]-trimethoxysilane |
|---|---|
| PubChem CID | 59664304 |
| Molecular Formula | C41H50O3Si3 |
| Molecular Weight | 675.11 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | [4-[4-[4-(2,6-dimethyl-4-phenylphenyl)phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]-trimethoxysilane |
| SMILES | CO[Si](OC)(OC)c1ccc(-c2cc([Si](C)(C)C)c(-c3ccc(-c4c(C)cc(-c5ccccc5)cc4C)cc3)c([Si](C)(C)C)c2)cc1 |
| InChI | InChI=1S/C41H50O3Si3/c1-29-25-35(31-15-13-12-14-16-31)26-30(2)40(29)33-17-19-34(20-18-33)41-38(45(6,7)8)27-36(28-39(41)46(9,10)11)32-21-23-37(24-22-32)47(42-3,43-4)44-5/h12-28H,1-11H3 |
| InChIKey | IEAXNKKFZZBVKA-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.11 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|