C40H40Si2 — CID 86091759
trimethyl-(5,6,7,8-tetraphenyl-3-trimethylsilylnaphthalen-2-yl)silane (PubChem CID 86091759) has the molecular formula C40H40Si2 and a molecular weight of 576.93 g/mol. Its IUPAC name is trimethyl-(5,6,7,8-tetraphenyl-3-trimethylsilylnaphthalen-2-yl)silane.
| Compound Name | trimethyl-(5,6,7,8-tetraphenyl-3-trimethylsilylnaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 86091759 |
| Molecular Formula | C40H40Si2 |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | trimethyl-(5,6,7,8-tetraphenyl-3-trimethylsilylnaphthalen-2-yl)silane |
| SMILES | C[Si](C)(C)c1cc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2cc1[Si](C)(C)C |
| InChI | InChI=1S/C40H40Si2/c1-41(2,3)35-27-33-34(28-36(35)42(4,5)6)38(30-21-13-8-14-22-30)40(32-25-17-10-18-26-32)39(31-23-15-9-16-24-31)37(33)29-19-11-7-12-20-29/h7-28H,1-6H3 |
| InChIKey | PKNVNNDNMIYIFB-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|