C34H30SeSi2 — CID 155642011
trimethyl-(4-phenyl-9-trimethylsilyl-3-selenaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),4,7,9,11,13(18),14,16(23),17(21),19-undecaen-23-yl)silane (PubChem CID 155642011) has the molecular formula C34H30SeSi2 and a molecular weight of 573.75 g/mol. Its IUPAC name is trimethyl-(4-phenyl-9-trimethylsilyl-3-selenaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),4,7,9,11,13(18),14,16(23),17(21),19-undecaen-23-yl)silane.
| Compound Name | trimethyl-(4-phenyl-9-trimethylsilyl-3-selenaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),4,7,9,11,13(18),14,16(23),17(21),19-undecaen-23-yl)silane |
|---|---|
| PubChem CID | 155642011 |
| Molecular Formula | C34H30SeSi2 |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | trimethyl-(4-phenyl-9-trimethylsilyl-3-selenaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),4,7,9,11,13(18),14,16(23),17(21),19-undecaen-23-yl)silane |
| SMILES | C[Si](C)(C)c1cc2c3cc(-c4ccccc4)[se]c3c3cc([Si](C)(C)C)c4ccc5ccc1c1c5c4c3c21 |
| InChI | InChI=1S/C34H30SeSi2/c1-36(2,3)27-17-23-24-16-26(19-10-8-7-9-11-19)35-34(24)25-18-28(37(4,5)6)22-15-13-20-12-14-21(27)30-29(20)31(22)33(25)32(23)30/h7-18H,1-6H3 |
| InChIKey | LIAVHTFLJOZVTP-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|