C22H14Se2 — CID 86054141
2,6-diphenylselenopheno[3,2-f][1]benzoselenole (PubChem CID 86054141) has the molecular formula C22H14Se2 and a molecular weight of 436.27 g/mol. Its IUPAC name is 2,6-diphenylselenopheno[3,2-f][1]benzoselenole.
| Compound Name | 2,6-diphenylselenopheno[3,2-f][1]benzoselenole |
|---|---|
| PubChem CID | 86054141 |
| Molecular Formula | C22H14Se2 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 437.94 |
| IUPAC Name | 2,6-diphenylselenopheno[3,2-f][1]benzoselenole |
| SMILES | c1ccc(-c2cc3cc4cc(-c5ccccc5)[se]c4cc3[se]2)cc1 |
| InChI | InChI=1S/C22H14Se2/c1-3-7-15(8-4-1)19-12-17-11-18-13-20(16-9-5-2-6-10-16)24-22(18)14-21(17)23-19/h1-14H |
| InChIKey | XOASEBHDMGWIKK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|