C22H17NSe — CID 153406893
4-(4,5-diphenylselenophen-2-yl)aniline (PubChem CID 153406893) has the molecular formula C22H17NSe and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-(4,5-diphenylselenophen-2-yl)aniline.
| Compound Name | 4-(4,5-diphenylselenophen-2-yl)aniline |
|---|---|
| PubChem CID | 153406893 |
| Molecular Formula | C22H17NSe |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-(4,5-diphenylselenophen-2-yl)aniline |
| SMILES | Nc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)[se]2)cc1 |
| InChI | InChI=1S/C22H17NSe/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H,23H2 |
| InChIKey | YVPZIOJPAANSRM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|