C40H26N2S4 — CID 140932080
4-[9-(4-aminophenyl)-14,19-diphenyl-3,10,13,20-tetrathiapentacyclo[15.3.0.02,6.07,11.012,16]icosa-1(17),2(6),4,7(11),8,12(16),14,18-octaen-4-yl]aniline (PubChem CID 140932080) has the molecular formula C40H26N2S4 and a molecular weight of 662.93 g/mol. Its IUPAC name is 4-[9-(4-aminophenyl)-14,19-diphenyl-3,10,13,20-tetrathiapentacyclo[15.3.0.02,6.07,11.012,16]icosa-1(17),2(6),4,7(11),8,12(16),14,18-octaen-4-yl]aniline.
| Compound Name | 4-[9-(4-aminophenyl)-14,19-diphenyl-3,10,13,20-tetrathiapentacyclo[15.3.0.02,6.07,11.012,16]icosa-1(17),2(6),4,7(11),8,12(16),14,18-octaen-4-yl]aniline |
|---|---|
| PubChem CID | 140932080 |
| Molecular Formula | C40H26N2S4 |
| Molecular Weight | 662.93 g/mol |
| Exact Mass | 662.10 |
| IUPAC Name | 4-[9-(4-aminophenyl)-14,19-diphenyl-3,10,13,20-tetrathiapentacyclo[15.3.0.02,6.07,11.012,16]icosa-1(17),2(6),4,7(11),8,12(16),14,18-octaen-4-yl]aniline |
| SMILES | Nc1ccc(-c2cc3c(s2)-c2sc(-c4ccccc4)cc2-c2cc(-c4ccccc4)sc2-c2sc(-c4ccc(N)cc4)cc2-3)cc1 |
| InChI | InChI=1S/C40H26N2S4/c41-27-15-11-25(12-16-27)35-21-31-32-22-36(26-13-17-28(42)18-14-26)46-40(32)38-30(20-34(44-38)24-9-5-2-6-10-24)29-19-33(23-7-3-1-4-8-23)43-37(29)39(31)45-35/h1-22H,41-42H2/b30-29-,32-31-,39-37-,40-38- |
| InChIKey | KWHZKMZNUQFEHO-IFHBKNKESA-N |
| XLogP | 12.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.93 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|