C30H20S3 — CID 101018673
3-phenyl-2,5-bis(3-phenylthiophen-2-yl)thiophene (PubChem CID 101018673) has the molecular formula C30H20S3 and a molecular weight of 476.69 g/mol. Its IUPAC name is 3-phenyl-2,5-bis(3-phenylthiophen-2-yl)thiophene.
| Compound Name | 3-phenyl-2,5-bis(3-phenylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 101018673 |
| Molecular Formula | C30H20S3 |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3-phenyl-2,5-bis(3-phenylthiophen-2-yl)thiophene |
| SMILES | c1ccc(-c2ccsc2-c2cc(-c3ccccc3)c(-c3sccc3-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C30H20S3/c1-4-10-21(11-5-1)24-16-18-31-28(24)27-20-26(23-14-8-3-9-15-23)30(33-27)29-25(17-19-32-29)22-12-6-2-7-13-22/h1-20H |
| InChIKey | OTXZOTMVMVGASB-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |