C14H8Cl2N2S — CID 151513214
4,6-dichloro-2-(3-phenylthiophen-2-yl)pyrimidine (PubChem CID 151513214) has the molecular formula C14H8Cl2N2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-phenylthiophen-2-yl)pyrimidine.
| Compound Name | 4,6-dichloro-2-(3-phenylthiophen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 151513214 |
| Molecular Formula | C14H8Cl2N2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 4,6-dichloro-2-(3-phenylthiophen-2-yl)pyrimidine |
| SMILES | Clc1cc(Cl)nc(-c2sccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C14H8Cl2N2S/c15-11-8-12(16)18-14(17-11)13-10(6-7-19-13)9-4-2-1-3-5-9/h1-8H |
| InChIKey | PSXKOYOOTPLYOK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |