C14H11ClN4S — CID 115914722
6-chloro-2-phenyl-N-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine (PubChem CID 115914722) has the molecular formula C14H11ClN4S and a molecular weight of 302.79 g/mol. Its IUPAC name is 6-chloro-2-phenyl-N-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-phenyl-N-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115914722 |
| Molecular Formula | C14H11ClN4S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 6-chloro-2-phenyl-N-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Clc1cc(NCc2nccs2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H11ClN4S/c15-11-8-12(17-9-13-16-6-7-20-13)19-14(18-11)10-4-2-1-3-5-10/h1-8H,9H2,(H,17,18,19) |
| InChIKey | QTQIWDJMLVBEPU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |