C16H18ClN3O — CID 114757208
2-[1-[[(6-chloro-2-phenylpyrimidin-4-yl)amino]methyl]cyclopropyl]ethanol (PubChem CID 114757208) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-[1-[[(6-chloro-2-phenylpyrimidin-4-yl)amino]methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[[(6-chloro-2-phenylpyrimidin-4-yl)amino]methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 114757208 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[1-[[(6-chloro-2-phenylpyrimidin-4-yl)amino]methyl]cyclopropyl]ethanol |
| SMILES | OCCC1(CNc2cc(Cl)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C16H18ClN3O/c17-13-10-14(18-11-16(6-7-16)8-9-21)20-15(19-13)12-4-2-1-3-5-12/h1-5,10,21H,6-9,11H2,(H,18,19,20) |
| InChIKey | ATINIIMODSQXQM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |