C22H13F3S — CID 46314133
2,3,5-tris(3-fluorophenyl)thiophene (PubChem CID 46314133) has the molecular formula C22H13F3S and a molecular weight of 366.41 g/mol. Its IUPAC name is 2,3,5-tris(3-fluorophenyl)thiophene.
| Compound Name | 2,3,5-tris(3-fluorophenyl)thiophene |
|---|---|
| PubChem CID | 46314133 |
| Molecular Formula | C22H13F3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2,3,5-tris(3-fluorophenyl)thiophene |
| SMILES | Fc1cccc(-c2cc(-c3cccc(F)c3)c(-c3cccc(F)c3)s2)c1 |
| InChI | InChI=1S/C22H13F3S/c23-17-7-1-4-14(10-17)20-13-21(15-5-2-8-18(24)11-15)26-22(20)16-6-3-9-19(25)12-16/h1-13H |
| InChIKey | SASNCUHJMQGAIM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |