C30H16F2S2 — CID 71263518
4,13-bis(3-fluorophenyl)-3,12-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(18),2(6),4,7(19),8,10(20),13,16-octaene (PubChem CID 71263518) has the molecular formula C30H16F2S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4,13-bis(3-fluorophenyl)-3,12-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(18),2(6),4,7(19),8,10(20),13,16-octaene.
| Compound Name | 4,13-bis(3-fluorophenyl)-3,12-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(18),2(6),4,7(19),8,10(20),13,16-octaene |
|---|---|
| PubChem CID | 71263518 |
| Molecular Formula | C30H16F2S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 4,13-bis(3-fluorophenyl)-3,12-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(18),2(6),4,7(19),8,10(20),13,16-octaene |
| SMILES | Fc1cccc(C2=CC3c4ccc5c6c(ccc(c46)C3S2)-c2cc(-c3cccc(F)c3)sc2-5)c1 |
| InChI | InChI=1S/C30H16F2S2/c31-17-5-1-3-15(11-17)25-13-23-19-7-10-22-28-20(8-9-21(27(19)28)29(23)33-25)24-14-26(34-30(22)24)16-4-2-6-18(32)12-16/h1-14,23,29H |
| InChIKey | VOWMSIDOPKFFPM-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |