C18H12O2S — CID 12530022
4-oxo-2,6-diphenylthiopyran-3-carbaldehyde (PubChem CID 12530022) has the molecular formula C18H12O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-oxo-2,6-diphenylthiopyran-3-carbaldehyde.
| Compound Name | 4-oxo-2,6-diphenylthiopyran-3-carbaldehyde |
|---|---|
| PubChem CID | 12530022 |
| Molecular Formula | C18H12O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-oxo-2,6-diphenylthiopyran-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)sc(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C18H12O2S/c19-12-15-16(20)11-17(13-7-3-1-4-8-13)21-18(15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | FITTYXGFOQPBEU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|