C22H16N2O2S4 — CID 132506893
3-[2-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)ethyl]-6-phenyl-2-sulfanylidene-1,3-thiazin-4-one (PubChem CID 132506893) has the molecular formula C22H16N2O2S4 and a molecular weight of 468.65 g/mol. Its IUPAC name is 3-[2-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)ethyl]-6-phenyl-2-sulfanylidene-1,3-thiazin-4-one.
| Compound Name | 3-[2-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)ethyl]-6-phenyl-2-sulfanylidene-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 132506893 |
| Molecular Formula | C22H16N2O2S4 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 3-[2-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)ethyl]-6-phenyl-2-sulfanylidene-1,3-thiazin-4-one |
| SMILES | O=c1cc(-c2ccccc2)sc(=S)n1CCn1c(=O)cc(-c2ccccc2)sc1=S |
| InChI | InChI=1S/C22H16N2O2S4/c25-19-13-17(15-7-3-1-4-8-15)29-21(27)23(19)11-12-24-20(26)14-18(30-22(24)28)16-9-5-2-6-10-16/h1-10,13-14H,11-12H2 |
| InChIKey | DTIWYHAJWCRMBF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|