C22H26N4O2S2 — CID 23848270
3-butyl-6-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-sulfanylidene-1,3-thiazin-4-one (PubChem CID 23848270) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 3-butyl-6-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-sulfanylidene-1,3-thiazin-4-one.
| Compound Name | 3-butyl-6-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-sulfanylidene-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 23848270 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-butyl-6-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-sulfanylidene-1,3-thiazin-4-one |
| SMILES | CCCCn1c(=O)cc(-c2c(N3CCC(C)CC3)nc3ccccn3c2=O)sc1=S |
| InChI | InChI=1S/C22H26N4O2S2/c1-3-4-10-26-18(27)14-16(30-22(26)29)19-20(24-12-8-15(2)9-13-24)23-17-7-5-6-11-25(17)21(19)28/h5-7,11,14-15H,3-4,8-10,12-13H2,1-2H3 |
| InChIKey | SSDOCKDUWDMRAR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|