C10H7NO2S — CID 133058764
2-oxo-5-phenyl-3H-1,3-thiazole-4-carbaldehyde (PubChem CID 133058764) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-oxo-5-phenyl-3H-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-oxo-5-phenyl-3H-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 133058764 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 2-oxo-5-phenyl-3H-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1[nH]c(=O)sc1-c1ccccc1 |
| InChI | InChI=1S/C10H7NO2S/c12-6-8-9(14-10(13)11-8)7-4-2-1-3-5-7/h1-6H,(H,11,13) |
| InChIKey | JIJYEOKGBRNOGG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|