C19H20OSSi — CID 11045581
(2,5-diphenylthiophen-3-yl)oxy-trimethylsilane (PubChem CID 11045581) has the molecular formula C19H20OSSi and a molecular weight of 324.52 g/mol. Its IUPAC name is (2,5-diphenylthiophen-3-yl)oxy-trimethylsilane.
| Compound Name | (2,5-diphenylthiophen-3-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 11045581 |
| Molecular Formula | C19H20OSSi |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2,5-diphenylthiophen-3-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1cc(-c2ccccc2)sc1-c1ccccc1 |
| InChI | InChI=1S/C19H20OSSi/c1-22(2,3)20-17-14-18(15-10-6-4-7-11-15)21-19(17)16-12-8-5-9-13-16/h4-14H,1-3H3 |
| InChIKey | YTLRCPQACBOXNP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|