C18H14Br2N2 — CID 89059489
4-[5-(4-aminophenyl)-2,4-dibromophenyl]aniline (PubChem CID 89059489) has the molecular formula C18H14Br2N2 and a molecular weight of 418.13 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-2,4-dibromophenyl]aniline.
| Compound Name | 4-[5-(4-aminophenyl)-2,4-dibromophenyl]aniline |
|---|---|
| PubChem CID | 89059489 |
| Molecular Formula | C18H14Br2N2 |
| Molecular Weight | 418.13 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 4-[5-(4-aminophenyl)-2,4-dibromophenyl]aniline |
| SMILES | Nc1ccc(-c2cc(-c3ccc(N)cc3)c(Br)cc2Br)cc1 |
| InChI | InChI=1S/C18H14Br2N2/c19-17-10-18(20)16(12-3-7-14(22)8-4-12)9-15(17)11-1-5-13(21)6-2-11/h1-10H,21-22H2 |
| InChIKey | QCZBGEJEFLJDJO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.13 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|