C24H32OSi2 — CID 139784627
[3-[dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-trimethylsilane (PubChem CID 139784627) has the molecular formula C24H32OSi2 and a molecular weight of 392.69 g/mol. Its IUPAC name is [3-[dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-trimethylsilane.
| Compound Name | [3-[dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 139784627 |
| Molecular Formula | C24H32OSi2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [3-[dimethyl-(2-phenylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-trimethylsilane |
| SMILES | COc1c([Si](C)(C)C)cc(C)cc1[Si](C)(C)C1=C(c2ccccc2)C=CC1 |
| InChI | InChI=1S/C24H32OSi2/c1-18-16-22(26(3,4)5)24(25-2)23(17-18)27(6,7)21-15-11-14-20(21)19-12-9-8-10-13-19/h8-14,16-17H,15H2,1-7H3 |
| InChIKey | MAUJHCQBLATZMF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|