C25H32OSi — CID 18347641
(2-tert-butylcyclopenta-1,3-dien-1-yl)-(2-methoxy-5-methyl-3-phenylphenyl)-dimethylsilane (PubChem CID 18347641) has the molecular formula C25H32OSi and a molecular weight of 376.62 g/mol. Its IUPAC name is (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2-methoxy-5-methyl-3-phenylphenyl)-dimethylsilane.
| Compound Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2-methoxy-5-methyl-3-phenylphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 18347641 |
| Molecular Formula | C25H32OSi |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2-methoxy-5-methyl-3-phenylphenyl)-dimethylsilane |
| SMILES | COc1c(-c2ccccc2)cc(C)cc1[Si](C)(C)C1=C(C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C25H32OSi/c1-18-16-20(19-12-9-8-10-13-19)24(26-5)23(17-18)27(6,7)22-15-11-14-21(22)25(2,3)4/h8-14,16-17H,15H2,1-7H3 |
| InChIKey | NSLBSCAHQRDGDX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|