C20H15F3O — CID 146622594
2-methoxy-1,3-diphenyl-5-(trifluoromethyl)benzene (PubChem CID 146622594) has the molecular formula C20H15F3O and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-methoxy-1,3-diphenyl-5-(trifluoromethyl)benzene.
| Compound Name | 2-methoxy-1,3-diphenyl-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146622594 |
| Molecular Formula | C20H15F3O |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-methoxy-1,3-diphenyl-5-(trifluoromethyl)benzene |
| SMILES | COc1c(-c2ccccc2)cc(C(F)(F)F)cc1-c1ccccc1 |
| InChI | InChI=1S/C20H15F3O/c1-24-19-17(14-8-4-2-5-9-14)12-16(20(21,22)23)13-18(19)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | AAIHBLVHEJHPBU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |