C27H34Si — CID 102204410
(5-hexyl-2,3-diphenylphenyl)-trimethylsilane (PubChem CID 102204410) has the molecular formula C27H34Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (5-hexyl-2,3-diphenylphenyl)-trimethylsilane.
| Compound Name | (5-hexyl-2,3-diphenylphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 102204410 |
| Molecular Formula | C27H34Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (5-hexyl-2,3-diphenylphenyl)-trimethylsilane |
| SMILES | CCCCCCc1cc(-c2ccccc2)c(-c2ccccc2)c([Si](C)(C)C)c1 |
| InChI | InChI=1S/C27H34Si/c1-5-6-7-10-15-22-20-25(23-16-11-8-12-17-23)27(24-18-13-9-14-19-24)26(21-22)28(2,3)4/h8-9,11-14,16-21H,5-7,10,15H2,1-4H3 |
| InChIKey | NJAVNJVDMRTGQQ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|