C45H62O3Si5 — CID 71121606
trimethoxy-[4-[4-[4-[4-phenyl-2,6-bis(trimethylsilyl)phenyl]phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]silane (PubChem CID 71121606) has the molecular formula C45H62O3Si5 and a molecular weight of 791.42 g/mol. Its IUPAC name is trimethoxy-[4-[4-[4-[4-phenyl-2,6-bis(trimethylsilyl)phenyl]phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]silane.
| Compound Name | trimethoxy-[4-[4-[4-[4-phenyl-2,6-bis(trimethylsilyl)phenyl]phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]silane |
|---|---|
| PubChem CID | 71121606 |
| Molecular Formula | C45H62O3Si5 |
| Molecular Weight | 791.42 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | trimethoxy-[4-[4-[4-[4-phenyl-2,6-bis(trimethylsilyl)phenyl]phenyl]-3,5-bis(trimethylsilyl)phenyl]phenyl]silane |
| SMILES | CO[Si](OC)(OC)c1ccc(-c2cc([Si](C)(C)C)c(-c3ccc(-c4c([Si](C)(C)C)cc(-c5ccccc5)cc4[Si](C)(C)C)cc3)c([Si](C)(C)C)c2)cc1 |
| InChI | InChI=1S/C45H62O3Si5/c1-46-53(47-2,48-3)39-27-25-34(26-28-39)38-31-42(51(10,11)12)45(43(32-38)52(13,14)15)36-23-21-35(22-24-36)44-40(49(4,5)6)29-37(30-41(44)50(7,8)9)33-19-17-16-18-20-33/h16-32H,1-15H3 |
| InChIKey | PSZLNKRKIOMGAQ-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.42 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|