About trichloro(phenyl)silane;trimethoxy(phenyl)silane
trichloro(phenyl)silane;trimethoxy(phenyl)silane (PubChem CID 160808399) has the molecular formula C15H19Cl3O3Si2
and a molecular weight of 409.85 g/mol. Its IUPAC name is trichloro(phenyl)silane;trimethoxy(phenyl)silane.
Molecular Properties
| Compound Name | trichloro(phenyl)silane;trimethoxy(phenyl)silane |
| PubChem CID | 160808399 |
| Molecular Formula | C15H19Cl3O3Si2 |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | trichloro(phenyl)silane;trimethoxy(phenyl)silane |
| SMILES | CO[Si](OC)(OC)c1ccccc1.Cl[Si](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C9H14O3Si.C6H5Cl3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;7-10(8,9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H |
| InChIKey | SDZNVTOAXKEOBQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(phenyl)silane;trimethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(phenyl)silane;trimethoxy(phenyl)silane?
The IUPAC name of trichloro(phenyl)silane;trimethoxy(phenyl)silane (CID 160808399) is trichloro(phenyl)silane;trimethoxy(phenyl)silane.
What is the SMILES notation for trichloro(phenyl)silane;trimethoxy(phenyl)silane?
The canonical SMILES for trichloro(phenyl)silane;trimethoxy(phenyl)silane is CO[Si](OC)(OC)c1ccccc1.Cl[Si](Cl)(Cl)c1ccccc1.
What is the InChIKey of trichloro(phenyl)silane;trimethoxy(phenyl)silane?
The InChIKey is SDZNVTOAXKEOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3Si.C6H5Cl3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;7-10(8,9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H.
What are the key properties of trichloro(phenyl)silane;trimethoxy(phenyl)silane?
trichloro(phenyl)silane;trimethoxy(phenyl)silane has a molecular weight of 409.85 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(phenyl)silane;trimethoxy(phenyl)silane is sourced from PubChem (CID 160808399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).