C13H12F3NS — CID 113415724
5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 113415724) has the molecular formula C13H12F3NS and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 113415724 |
| Molecular Formula | C13H12F3NS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-propan-2-yl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | CC(C)c1cnc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C13H12F3NS/c1-8(2)11-7-17-12(18-11)9-4-3-5-10(6-9)13(14,15)16/h3-8H,1-2H3 |
| InChIKey | DUOMGVFNIKOWQF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |